C17H22F2O — CID 118583535
3-(2,3-difluoro-4-methylphenyl)-6-pentyl-3,4-dihydro-2H-pyran (PubChem CID 118583535) has the molecular formula C17H22F2O and a molecular weight of 280.36 g/mol. Its IUPAC name is 3-(2,3-difluoro-4-methylphenyl)-6-pentyl-3,4-dihydro-2H-pyran.
| Compound Name | 3-(2,3-difluoro-4-methylphenyl)-6-pentyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 118583535 |
| Molecular Formula | C17H22F2O |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 3-(2,3-difluoro-4-methylphenyl)-6-pentyl-3,4-dihydro-2H-pyran |
| SMILES | CCCCCC1=CCC(c2ccc(C)c(F)c2F)CO1 |
| InChI | InChI=1S/C17H22F2O/c1-3-4-5-6-14-9-8-13(11-20-14)15-10-7-12(2)16(18)17(15)19/h7,9-10,13H,3-6,8,11H2,1-2H3 |
| InChIKey | YVVPZYAUJYZAHL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|