C30H39FO — CID 118583725
3-[4-[4-(4-ethylcyclohexyl)-3-fluorophenyl]phenyl]-6-pentyl-3,4-dihydro-2H-pyran (PubChem CID 118583725) has the molecular formula C30H39FO and a molecular weight of 434.64 g/mol. Its IUPAC name is 3-[4-[4-(4-ethylcyclohexyl)-3-fluorophenyl]phenyl]-6-pentyl-3,4-dihydro-2H-pyran.
| Compound Name | 3-[4-[4-(4-ethylcyclohexyl)-3-fluorophenyl]phenyl]-6-pentyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 118583725 |
| Molecular Formula | C30H39FO |
| Molecular Weight | 434.64 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | 3-[4-[4-(4-ethylcyclohexyl)-3-fluorophenyl]phenyl]-6-pentyl-3,4-dihydro-2H-pyran |
| SMILES | CCCCCC1=CCC(c2ccc(-c3ccc(C4CCC(CC)CC4)c(F)c3)cc2)CO1 |
| InChI | InChI=1S/C30H39FO/c1-3-5-6-7-28-18-16-27(21-32-28)24-14-12-23(13-15-24)26-17-19-29(30(31)20-26)25-10-8-22(4-2)9-11-25/h12-15,17-20,22,25,27H,3-11,16,21H2,1-2H3 |
| InChIKey | PSSBBAGWVXVVBS-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.64 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|