C18H25FO2 — CID 118583525
3-(4-ethoxy-3-fluorophenyl)-6-pentyl-3,4-dihydro-2H-pyran (PubChem CID 118583525) has the molecular formula C18H25FO2 and a molecular weight of 292.39 g/mol. Its IUPAC name is 3-(4-ethoxy-3-fluorophenyl)-6-pentyl-3,4-dihydro-2H-pyran.
| Compound Name | 3-(4-ethoxy-3-fluorophenyl)-6-pentyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 118583525 |
| Molecular Formula | C18H25FO2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 3-(4-ethoxy-3-fluorophenyl)-6-pentyl-3,4-dihydro-2H-pyran |
| SMILES | CCCCCC1=CCC(c2ccc(OCC)c(F)c2)CO1 |
| InChI | InChI=1S/C18H25FO2/c1-3-5-6-7-16-10-8-15(13-21-16)14-9-11-18(20-4-2)17(19)12-14/h9-12,15H,3-8,13H2,1-2H3 |
| InChIKey | XNRSKSWFURLJTK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|