C28H32F4O2 — CID 118583554
3-(7-butoxy-3,4,5,6-tetrafluoro-9,10-dihydrophenanthren-2-yl)-6-pentyl-3,4-dihydro-2H-pyran (PubChem CID 118583554) has the molecular formula C28H32F4O2 and a molecular weight of 476.55 g/mol. Its IUPAC name is 3-(7-butoxy-3,4,5,6-tetrafluoro-9,10-dihydrophenanthren-2-yl)-6-pentyl-3,4-dihydro-2H-pyran.
| Compound Name | 3-(7-butoxy-3,4,5,6-tetrafluoro-9,10-dihydrophenanthren-2-yl)-6-pentyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 118583554 |
| Molecular Formula | C28H32F4O2 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 3-(7-butoxy-3,4,5,6-tetrafluoro-9,10-dihydrophenanthren-2-yl)-6-pentyl-3,4-dihydro-2H-pyran |
| SMILES | CCCCCC1=CCC(c2cc3c(c(F)c2F)-c2c(cc(OCCCC)c(F)c2F)CC3)CO1 |
| InChI | InChI=1S/C28H32F4O2/c1-3-5-7-8-20-12-11-19(16-34-20)21-14-17-9-10-18-15-22(33-13-6-4-2)26(30)28(32)24(18)23(17)27(31)25(21)29/h12,14-15,19H,3-11,13,16H2,1-2H3 |
| InChIKey | BODRIGAXZVRIRD-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|