C20H21F3O — CID 69416127
2-butoxy-3,4,5-trifluoro-6-propyl-9H-fluorene (PubChem CID 69416127) has the molecular formula C20H21F3O and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-butoxy-3,4,5-trifluoro-6-propyl-9H-fluorene.
| Compound Name | 2-butoxy-3,4,5-trifluoro-6-propyl-9H-fluorene |
|---|---|
| PubChem CID | 69416127 |
| Molecular Formula | C20H21F3O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-butoxy-3,4,5-trifluoro-6-propyl-9H-fluorene |
| SMILES | CCCCOc1cc2c(c(F)c1F)-c1c(ccc(CCC)c1F)C2 |
| InChI | InChI=1S/C20H21F3O/c1-3-5-9-24-15-11-14-10-13-8-7-12(6-4-2)18(21)16(13)17(14)20(23)19(15)22/h7-8,11H,3-6,9-10H2,1-2H3 |
| InChIKey | SQSXMUSYZBDTSL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|