C16H21FO — CID 71422813
4-(4-ethenylcyclohexyl)-1-ethoxy-2-fluorobenzene (PubChem CID 71422813) has the molecular formula C16H21FO and a molecular weight of 248.34 g/mol. Its IUPAC name is 4-(4-ethenylcyclohexyl)-1-ethoxy-2-fluorobenzene.
| Compound Name | 4-(4-ethenylcyclohexyl)-1-ethoxy-2-fluorobenzene |
|---|---|
| PubChem CID | 71422813 |
| Molecular Formula | C16H21FO |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 4-(4-ethenylcyclohexyl)-1-ethoxy-2-fluorobenzene |
| SMILES | C=CC1CCC(c2ccc(OCC)c(F)c2)CC1 |
| InChI | InChI=1S/C16H21FO/c1-3-12-5-7-13(8-6-12)14-9-10-16(18-4-2)15(17)11-14/h3,9-13H,1,4-8H2,2H3 |
| InChIKey | MYROAEKFGUHWND-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|