C27H26F2O2 — CID 138459509
2-ethenyl-5-[4-[4-(4-ethoxy-3-fluorophenyl)phenyl]-3-fluorophenyl]oxane (PubChem CID 138459509) has the molecular formula C27H26F2O2 and a molecular weight of 420.50 g/mol. Its IUPAC name is 2-ethenyl-5-[4-[4-(4-ethoxy-3-fluorophenyl)phenyl]-3-fluorophenyl]oxane.
| Compound Name | 2-ethenyl-5-[4-[4-(4-ethoxy-3-fluorophenyl)phenyl]-3-fluorophenyl]oxane |
|---|---|
| PubChem CID | 138459509 |
| Molecular Formula | C27H26F2O2 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 2-ethenyl-5-[4-[4-(4-ethoxy-3-fluorophenyl)phenyl]-3-fluorophenyl]oxane |
| SMILES | C=CC1CCC(c2ccc(-c3ccc(-c4ccc(OCC)c(F)c4)cc3)c(F)c2)CO1 |
| InChI | InChI=1S/C27H26F2O2/c1-3-23-12-9-22(17-31-23)21-10-13-24(25(28)15-21)19-7-5-18(6-8-19)20-11-14-27(30-4-2)26(29)16-20/h3,5-8,10-11,13-16,22-23H,1,4,9,12,17H2,2H3 |
| InChIKey | FWIWRYMRJYYXTE-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|