C26H22BF3O2 — CID 88998279
CID 88998279 (PubChem CID 88998279) has the molecular formula C26H22BF3O2 and a molecular weight of 434.27 g/mol.
| Compound Name | CID 88998279 |
|---|---|
| PubChem CID | 88998279 |
| Molecular Formula | C26H22BF3O2 |
| Molecular Weight | 434.27 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | — |
| SMILES | [B]COc1ccc(-c2ccc(-c3ccc(C4CCC(C=C)OC4)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C26H22BF3O2/c1-2-20-9-7-19(14-31-20)21-10-8-18(13-23(21)28)16-3-5-17(6-4-16)22-11-12-24(32-15-27)26(30)25(22)29/h2-6,8,10-13,19-20H,1,7,9,14-15H2 |
| InChIKey | ZMMTXCFAHMHWRK-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.27 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|