C28H25BF4O2 — CID 88998295
CID 88998295 (PubChem CID 88998295) has the molecular formula C28H25BF4O2 and a molecular weight of 480.31 g/mol.
| Compound Name | CID 88998295 |
|---|---|
| PubChem CID | 88998295 |
| Molecular Formula | C28H25BF4O2 |
| Molecular Weight | 480.31 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | — |
| SMILES | [B]COc1ccc(-c2ccc(-c3ccc(C4CCC(CCC=C)OC4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C28H25BF4O2/c1-2-3-4-20-10-9-19(15-34-20)23-12-11-21(25(30)26(23)31)17-5-7-18(8-6-17)22-13-14-24(35-16-29)28(33)27(22)32/h2,5-8,11-14,19-20H,1,3-4,9-10,15-16H2 |
| InChIKey | MGKQXEXMCMCKEX-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.31 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|