C28H25F5O2 — CID 76816020
5-[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-3-fluorophenyl]-2-prop-1-enyloxane (PubChem CID 76816020) has the molecular formula C28H25F5O2 and a molecular weight of 488.50 g/mol. Its IUPAC name is 5-[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-3-fluorophenyl]-2-prop-1-enyloxane.
| Compound Name | 5-[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-3-fluorophenyl]-2-prop-1-enyloxane |
|---|---|
| PubChem CID | 76816020 |
| Molecular Formula | C28H25F5O2 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 5-[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-3-fluorophenyl]-2-prop-1-enyloxane |
| SMILES | CC=CC1CCC(c2ccc(-c3ccc(-c4ccc(OCC)c(F)c4F)c(F)c3F)c(F)c2)CO1 |
| InChI | InChI=1S/C28H25F5O2/c1-3-5-18-8-6-17(15-35-18)16-7-9-19(23(29)14-16)20-10-11-21(26(31)25(20)30)22-12-13-24(34-4-2)28(33)27(22)32/h3,5,7,9-14,17-18H,4,6,8,15H2,1-2H3 |
| InChIKey | YMOUAROORVNZKM-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|