C24H24F4O — CID 76631877
1-[4-(2,3-difluoro-4-methoxyphenyl)cyclohex-3-en-1-yl]-2,3-difluoro-4-pent-3-enylbenzene (PubChem CID 76631877) has the molecular formula C24H24F4O and a molecular weight of 404.45 g/mol. Its IUPAC name is 1-[4-(2,3-difluoro-4-methoxyphenyl)cyclohex-3-en-1-yl]-2,3-difluoro-4-pent-3-enylbenzene.
| Compound Name | 1-[4-(2,3-difluoro-4-methoxyphenyl)cyclohex-3-en-1-yl]-2,3-difluoro-4-pent-3-enylbenzene |
|---|---|
| PubChem CID | 76631877 |
| Molecular Formula | C24H24F4O |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 1-[4-(2,3-difluoro-4-methoxyphenyl)cyclohex-3-en-1-yl]-2,3-difluoro-4-pent-3-enylbenzene |
| SMILES | CC=CCCc1ccc(C2CC=C(c3ccc(OC)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C24H24F4O/c1-3-4-5-6-17-11-12-18(22(26)21(17)25)15-7-9-16(10-8-15)19-13-14-20(29-2)24(28)23(19)27/h3-4,9,11-15H,5-8,10H2,1-2H3 |
| InChIKey | USQNNSPKJIGLKY-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|