C25H36F2O3 — CID 118583578
3-[(4-ethoxy-2,3-difluorophenoxy)methyl]-6-(4-pentylcyclohexyl)-3,4-dihydro-2H-pyran (PubChem CID 118583578) has the molecular formula C25H36F2O3 and a molecular weight of 422.56 g/mol. Its IUPAC name is 3-[(4-ethoxy-2,3-difluorophenoxy)methyl]-6-(4-pentylcyclohexyl)-3,4-dihydro-2H-pyran.
| Compound Name | 3-[(4-ethoxy-2,3-difluorophenoxy)methyl]-6-(4-pentylcyclohexyl)-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 118583578 |
| Molecular Formula | C25H36F2O3 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 3-[(4-ethoxy-2,3-difluorophenoxy)methyl]-6-(4-pentylcyclohexyl)-3,4-dihydro-2H-pyran |
| SMILES | CCCCCC1CCC(C2=CCC(COc3ccc(OCC)c(F)c3F)CO2)CC1 |
| InChI | InChI=1S/C25H36F2O3/c1-3-5-6-7-18-8-11-20(12-9-18)21-13-10-19(16-29-21)17-30-23-15-14-22(28-4-2)24(26)25(23)27/h13-15,18-20H,3-12,16-17H2,1-2H3 |
| InChIKey | ZOSHANYMJAWIEA-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|