C21H19F5 — CID 121476182
2-(4-ethyl-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)-1-fluoro-6-propylnaphthalene (PubChem CID 121476182) has the molecular formula C21H19F5 and a molecular weight of 366.37 g/mol. Its IUPAC name is 2-(4-ethyl-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)-1-fluoro-6-propylnaphthalene.
| Compound Name | 2-(4-ethyl-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)-1-fluoro-6-propylnaphthalene |
|---|---|
| PubChem CID | 121476182 |
| Molecular Formula | C21H19F5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-(4-ethyl-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)-1-fluoro-6-propylnaphthalene |
| SMILES | CCCc1ccc2c(F)c(C3=CC=C(CC)C(F)(F)C3(F)F)ccc2c1 |
| InChI | InChI=1S/C21H19F5/c1-3-5-13-6-9-16-14(12-13)7-10-17(19(16)22)18-11-8-15(4-2)20(23,24)21(18,25)26/h6-12H,3-5H2,1-2H3 |
| InChIKey | ATGAYSJLPUEBKI-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|