C23H23F4N — CID 121476271
5-(4-propylphenyl)-2-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)pyridine (PubChem CID 121476271) has the molecular formula C23H23F4N and a molecular weight of 389.44 g/mol. Its IUPAC name is 5-(4-propylphenyl)-2-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)pyridine.
| Compound Name | 5-(4-propylphenyl)-2-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)pyridine |
|---|---|
| PubChem CID | 121476271 |
| Molecular Formula | C23H23F4N |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 5-(4-propylphenyl)-2-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)pyridine |
| SMILES | CCCC1=CC=C(c2ccc(-c3ccc(CCC)cc3)cn2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C23H23F4N/c1-3-5-16-7-9-17(10-8-16)18-11-14-21(28-15-18)20-13-12-19(6-4-2)22(24,25)23(20,26)27/h7-15H,3-6H2,1-2H3 |
| InChIKey | MNTGWRQAKNVGOV-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|