C26H34F4 — CID 121476332
5,5,6,6-tetrafluoro-1-(4-propylcyclohexyl)-4-[2-(4-propylphenyl)ethyl]cyclohexa-1,3-diene (PubChem CID 121476332) has the molecular formula C26H34F4 and a molecular weight of 422.55 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoro-1-(4-propylcyclohexyl)-4-[2-(4-propylphenyl)ethyl]cyclohexa-1,3-diene.
| Compound Name | 5,5,6,6-tetrafluoro-1-(4-propylcyclohexyl)-4-[2-(4-propylphenyl)ethyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476332 |
| Molecular Formula | C26H34F4 |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 5,5,6,6-tetrafluoro-1-(4-propylcyclohexyl)-4-[2-(4-propylphenyl)ethyl]cyclohexa-1,3-diene |
| SMILES | CCCc1ccc(CCC2=CC=C(C3CCC(CCC)CC3)C(F)(F)C2(F)F)cc1 |
| InChI | InChI=1S/C26H34F4/c1-3-5-19-7-9-21(10-8-19)13-16-23-17-18-24(26(29,30)25(23,27)28)22-14-11-20(6-4-2)12-15-22/h7-10,17-18,20,22H,3-6,11-16H2,1-2H3 |
| InChIKey | YFOLRLDGKWFQPW-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|