C18H26F2 — CID 67878604
1-[(1R,4S)-2,2-difluoro-4-propylcyclohexyl]-4-propylbenzene (PubChem CID 67878604) has the molecular formula C18H26F2 and a molecular weight of 280.40 g/mol. Its IUPAC name is 1-[(1R,4S)-2,2-difluoro-4-propylcyclohexyl]-4-propylbenzene.
| Compound Name | 1-[(1R,4S)-2,2-difluoro-4-propylcyclohexyl]-4-propylbenzene |
|---|---|
| PubChem CID | 67878604 |
| Molecular Formula | C18H26F2 |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 1-[(1R,4S)-2,2-difluoro-4-propylcyclohexyl]-4-propylbenzene |
| SMILES | CCCc1ccc([C@H]2CC[C@H](CCC)CC2(F)F)cc1 |
| InChI | InChI=1S/C18H26F2/c1-3-5-14-7-10-16(11-8-14)17-12-9-15(6-4-2)13-18(17,19)20/h7-8,10-11,15,17H,3-6,9,12-13H2,1-2H3/t15-,17+/m0/s1 |
| InChIKey | KTCYCZGSPKGYST-DOTOQJQBSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |