C27H40F2 — CID 130352201
1-[4-[(E)-4-(2,2-difluoro-4-propylcyclohexyl)but-1-enyl]cyclohexyl]-4-ethylbenzene (PubChem CID 130352201) has the molecular formula C27H40F2 and a molecular weight of 402.61 g/mol. Its IUPAC name is 1-[4-[(E)-4-(2,2-difluoro-4-propylcyclohexyl)but-1-enyl]cyclohexyl]-4-ethylbenzene.
| Compound Name | 1-[4-[(E)-4-(2,2-difluoro-4-propylcyclohexyl)but-1-enyl]cyclohexyl]-4-ethylbenzene |
|---|---|
| PubChem CID | 130352201 |
| Molecular Formula | C27H40F2 |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | 1-[4-[(E)-4-(2,2-difluoro-4-propylcyclohexyl)but-1-enyl]cyclohexyl]-4-ethylbenzene |
| SMILES | CCCC1CCC(CC/C=C/C2CCC(c3ccc(CC)cc3)CC2)C(F)(F)C1 |
| InChI | InChI=1S/C27H40F2/c1-3-7-23-14-19-26(27(28,29)20-23)9-6-5-8-22-12-17-25(18-13-22)24-15-10-21(4-2)11-16-24/h5,8,10-11,15-16,22-23,25-26H,3-4,6-7,9,12-14,17-20H2,1-2H3/b8-5+ |
| InChIKey | UGJAZIQGWJNBGN-VMPITWQZSA-N |
| XLogP | 8.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|