C25H38F4 — CID 121476149
1-ethyl-5,5,6,6-tetrafluoro-4-[2-[4-(4-propylcyclohexyl)cyclohexyl]ethyl]cyclohexa-1,3-diene (PubChem CID 121476149) has the molecular formula C25H38F4 and a molecular weight of 414.57 g/mol. Its IUPAC name is 1-ethyl-5,5,6,6-tetrafluoro-4-[2-[4-(4-propylcyclohexyl)cyclohexyl]ethyl]cyclohexa-1,3-diene.
| Compound Name | 1-ethyl-5,5,6,6-tetrafluoro-4-[2-[4-(4-propylcyclohexyl)cyclohexyl]ethyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476149 |
| Molecular Formula | C25H38F4 |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | 1-ethyl-5,5,6,6-tetrafluoro-4-[2-[4-(4-propylcyclohexyl)cyclohexyl]ethyl]cyclohexa-1,3-diene |
| SMILES | CCCC1CCC(C2CCC(CCC3=CC=C(CC)C(F)(F)C3(F)F)CC2)CC1 |
| InChI | InChI=1S/C25H38F4/c1-3-5-18-6-11-20(12-7-18)21-13-8-19(9-14-21)10-15-23-17-16-22(4-2)24(26,27)25(23,28)29/h16-21H,3-15H2,1-2H3 |
| InChIKey | PMWOXTGKGVTCEM-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|