C33H46F4O — CID 121476370
5,5,6,6-tetrafluoro-1-[[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]methoxy]-4-propylcyclohexa-1,3-diene (PubChem CID 121476370) has the molecular formula C33H46F4O and a molecular weight of 534.72 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoro-1-[[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]methoxy]-4-propylcyclohexa-1,3-diene.
| Compound Name | 5,5,6,6-tetrafluoro-1-[[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]methoxy]-4-propylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476370 |
| Molecular Formula | C33H46F4O |
| Molecular Weight | 534.72 g/mol |
| Exact Mass | 534.35 |
| IUPAC Name | 5,5,6,6-tetrafluoro-1-[[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]methoxy]-4-propylcyclohexa-1,3-diene |
| SMILES | CCCCCC1CCC(C2CCC(c3ccc(COC4=CC=C(CCC)C(F)(F)C4(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C33H46F4O/c1-3-5-6-8-24-9-13-26(14-10-24)28-17-19-29(20-18-28)27-15-11-25(12-16-27)23-38-31-22-21-30(7-4-2)32(34,35)33(31,36)37/h11-12,15-16,21-22,24,26,28-29H,3-10,13-14,17-20,23H2,1-2H3 |
| InChIKey | REVBHYLGDOZNNM-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.72 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|