C24H34F4O — CID 121476238
5,5,6,6-tetrafluoro-1-prop-2-enoxy-4-[4-(4-propylcyclohexyl)cyclohexyl]cyclohexa-1,3-diene (PubChem CID 121476238) has the molecular formula C24H34F4O and a molecular weight of 414.53 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoro-1-prop-2-enoxy-4-[4-(4-propylcyclohexyl)cyclohexyl]cyclohexa-1,3-diene.
| Compound Name | 5,5,6,6-tetrafluoro-1-prop-2-enoxy-4-[4-(4-propylcyclohexyl)cyclohexyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476238 |
| Molecular Formula | C24H34F4O |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 5,5,6,6-tetrafluoro-1-prop-2-enoxy-4-[4-(4-propylcyclohexyl)cyclohexyl]cyclohexa-1,3-diene |
| SMILES | C=CCOC1=CC=C(C2CCC(C3CCC(CCC)CC3)CC2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C24H34F4O/c1-3-5-17-6-8-18(9-7-17)19-10-12-20(13-11-19)21-14-15-22(29-16-4-2)24(27,28)23(21,25)26/h4,14-15,17-20H,2-3,5-13,16H2,1H3 |
| InChIKey | DIANIFLVWOJERC-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|