C27H34F4 — CID 121476355
5,5,6,6-tetrafluoro-1-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]cyclohexa-1,3-diene (PubChem CID 121476355) has the molecular formula C27H34F4 and a molecular weight of 434.56 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoro-1-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]cyclohexa-1,3-diene.
| Compound Name | 5,5,6,6-tetrafluoro-1-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476355 |
| Molecular Formula | C27H34F4 |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 5,5,6,6-tetrafluoro-1-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]cyclohexa-1,3-diene |
| SMILES | CCCC1CCC(C2CCC(c3ccc(C4=CC=CC(F)(F)C4(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C27H34F4/c1-2-4-19-6-8-20(9-7-19)21-10-12-22(13-11-21)23-14-16-24(17-15-23)25-5-3-18-26(28,29)27(25,30)31/h3,5,14-22H,2,4,6-13H2,1H3 |
| InChIKey | MHWPGDDETIFREJ-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|