C25H28F4 — CID 139850222
3,3,4,4-tetrafluoro-7-[4-(4-propylcyclohexyl)phenyl]-1,2-dihydronaphthalene (PubChem CID 139850222) has the molecular formula C25H28F4 and a molecular weight of 404.49 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-7-[4-(4-propylcyclohexyl)phenyl]-1,2-dihydronaphthalene.
| Compound Name | 3,3,4,4-tetrafluoro-7-[4-(4-propylcyclohexyl)phenyl]-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139850222 |
| Molecular Formula | C25H28F4 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 3,3,4,4-tetrafluoro-7-[4-(4-propylcyclohexyl)phenyl]-1,2-dihydronaphthalene |
| SMILES | CCCC1CCC(c2ccc(-c3ccc4c(c3)CCC(F)(F)C4(F)F)cc2)CC1 |
| InChI | InChI=1S/C25H28F4/c1-2-3-17-4-6-18(7-5-17)19-8-10-20(11-9-19)21-12-13-23-22(16-21)14-15-24(26,27)25(23,28)29/h8-13,16-18H,2-7,14-15H2,1H3 |
| InChIKey | CKHVZGNHPCAEJO-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|