C27H31F5 — CID 139850255
3,3,4,4,5-pentafluoro-7-[4-(4-pentylcyclohexyl)phenyl]-1,2-dihydronaphthalene (PubChem CID 139850255) has the molecular formula C27H31F5 and a molecular weight of 450.54 g/mol. Its IUPAC name is 3,3,4,4,5-pentafluoro-7-[4-(4-pentylcyclohexyl)phenyl]-1,2-dihydronaphthalene.
| Compound Name | 3,3,4,4,5-pentafluoro-7-[4-(4-pentylcyclohexyl)phenyl]-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139850255 |
| Molecular Formula | C27H31F5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 3,3,4,4,5-pentafluoro-7-[4-(4-pentylcyclohexyl)phenyl]-1,2-dihydronaphthalene |
| SMILES | CCCCCC1CCC(c2ccc(-c3cc(F)c4c(c3)CCC(F)(F)C4(F)F)cc2)CC1 |
| InChI | InChI=1S/C27H31F5/c1-2-3-4-5-18-6-8-19(9-7-18)20-10-12-21(13-11-20)23-16-22-14-15-26(29,30)27(31,32)25(22)24(28)17-23/h10-13,16-19H,2-9,14-15H2,1H3 |
| InChIKey | DWZRRNMTVOXNHB-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|