C24H24F4 — CID 139850270
6-[4-(4-ethylcyclohexyl)phenyl]-1,1,2,2-tetrafluoronaphthalene (PubChem CID 139850270) has the molecular formula C24H24F4 and a molecular weight of 388.45 g/mol. Its IUPAC name is 6-[4-(4-ethylcyclohexyl)phenyl]-1,1,2,2-tetrafluoronaphthalene.
| Compound Name | 6-[4-(4-ethylcyclohexyl)phenyl]-1,1,2,2-tetrafluoronaphthalene |
|---|---|
| PubChem CID | 139850270 |
| Molecular Formula | C24H24F4 |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 6-[4-(4-ethylcyclohexyl)phenyl]-1,1,2,2-tetrafluoronaphthalene |
| SMILES | CCC1CCC(c2ccc(-c3ccc4c(c3)C=CC(F)(F)C4(F)F)cc2)CC1 |
| InChI | InChI=1S/C24H24F4/c1-2-16-3-5-17(6-4-16)18-7-9-19(10-8-18)20-11-12-22-21(15-20)13-14-23(25,26)24(22,27)28/h7-17H,2-6H2,1H3 |
| InChIKey | HQNOWEQAVMOJGO-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|