C25H31F5 — CID 139850159
1,1,2,2,8-pentafluoro-6-[4-(4-propylcyclohexyl)cyclohexyl]naphthalene (PubChem CID 139850159) has the molecular formula C25H31F5 and a molecular weight of 426.51 g/mol. Its IUPAC name is 1,1,2,2,8-pentafluoro-6-[4-(4-propylcyclohexyl)cyclohexyl]naphthalene.
| Compound Name | 1,1,2,2,8-pentafluoro-6-[4-(4-propylcyclohexyl)cyclohexyl]naphthalene |
|---|---|
| PubChem CID | 139850159 |
| Molecular Formula | C25H31F5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 1,1,2,2,8-pentafluoro-6-[4-(4-propylcyclohexyl)cyclohexyl]naphthalene |
| SMILES | CCCC1CCC(C2CCC(c3cc(F)c4c(c3)C=CC(F)(F)C4(F)F)CC2)CC1 |
| InChI | InChI=1S/C25H31F5/c1-2-3-16-4-6-17(7-5-16)18-8-10-19(11-9-18)21-14-20-12-13-24(27,28)25(29,30)23(20)22(26)15-21/h12-19H,2-11H2,1H3 |
| InChIKey | VLSWJCOGYWIEMD-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|