C50H56O2 — CID 126752022
7-[4-(4-propylcyclohexyl)phenyl]-1-[7-[4-(4-propylcyclohexyl)phenyl]naphthalen-1-yl]-1H-naphthalene-2,2-diol (PubChem CID 126752022) has the molecular formula C50H56O2 and a molecular weight of 689.00 g/mol. Its IUPAC name is 7-[4-(4-propylcyclohexyl)phenyl]-1-[7-[4-(4-propylcyclohexyl)phenyl]naphthalen-1-yl]-1H-naphthalene-2,2-diol.
| Compound Name | 7-[4-(4-propylcyclohexyl)phenyl]-1-[7-[4-(4-propylcyclohexyl)phenyl]naphthalen-1-yl]-1H-naphthalene-2,2-diol |
|---|---|
| PubChem CID | 126752022 |
| Molecular Formula | C50H56O2 |
| Molecular Weight | 689.00 g/mol |
| Exact Mass | 688.43 |
| IUPAC Name | 7-[4-(4-propylcyclohexyl)phenyl]-1-[7-[4-(4-propylcyclohexyl)phenyl]naphthalen-1-yl]-1H-naphthalene-2,2-diol |
| SMILES | CCCC1CCC(c2ccc(-c3ccc4c(c3)C(c3cccc5ccc(-c6ccc(C7CCC(CCC)CC7)cc6)cc35)C(O)(O)C=C4)cc2)CC1 |
| InChI | InChI=1S/C50H56O2/c1-3-6-34-10-14-36(15-11-34)38-18-22-40(23-19-38)44-28-26-42-8-5-9-46(47(42)32-44)49-48-33-45(29-27-43(48)30-31-50(49,51)52)41-24-20-39(21-25-41)37-16-12-35(7-4-2)13-17-37/h5,8-9,18-37,49,51-52H,3-4,6-7,10-17H2,1-2H3 |
| InChIKey | BJGOUPSGLYIFCS-UHFFFAOYSA-N |
| XLogP | 13.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.00 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|