C17H22BFO2 — CID 174994822
(1-fluoro-5-pentyl-2-phenylcyclohexa-2,4-dien-1-yl)boronic acid (PubChem CID 174994822) has the molecular formula C17H22BFO2 and a molecular weight of 288.17 g/mol. Its IUPAC name is (1-fluoro-5-pentyl-2-phenylcyclohexa-2,4-dien-1-yl)boronic acid.
| Compound Name | (1-fluoro-5-pentyl-2-phenylcyclohexa-2,4-dien-1-yl)boronic acid |
|---|---|
| PubChem CID | 174994822 |
| Molecular Formula | C17H22BFO2 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (1-fluoro-5-pentyl-2-phenylcyclohexa-2,4-dien-1-yl)boronic acid |
| SMILES | CCCCCC1=CC=C(c2ccccc2)C(F)(B(O)O)C1 |
| InChI | InChI=1S/C17H22BFO2/c1-2-3-5-8-14-11-12-16(15-9-6-4-7-10-15)17(19,13-14)18(20)21/h4,6-7,9-12,20-21H,2-3,5,8,13H2,1H3 |
| InChIKey | OIJRFJNBNCZIJM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|