C16H19Br — CID 174623341
1,1'-biphenyl;1-bromobutane (PubChem CID 174623341) has the molecular formula C16H19Br and a molecular weight of 291.23 g/mol. Its IUPAC name is 1,1'-biphenyl;1-bromobutane.
| Compound Name | 1,1'-biphenyl;1-bromobutane |
|---|---|
| PubChem CID | 174623341 |
| Molecular Formula | C16H19Br |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 1,1'-biphenyl;1-bromobutane |
| SMILES | CCCCBr.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C4H9Br/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-3-4-5/h1-10H;2-4H2,1H3 |
| InChIKey | KFMBEELEDYHAIO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|