C23H26F4O2 — CID 162620984
1-ethyl-2,2,3,3-tetrafluoro-4-[4-(4-propylphenyl)phenyl]cyclohexane-1,4-diol (PubChem CID 162620984) has the molecular formula C23H26F4O2 and a molecular weight of 410.45 g/mol. Its IUPAC name is 1-ethyl-2,2,3,3-tetrafluoro-4-[4-(4-propylphenyl)phenyl]cyclohexane-1,4-diol.
| Compound Name | 1-ethyl-2,2,3,3-tetrafluoro-4-[4-(4-propylphenyl)phenyl]cyclohexane-1,4-diol |
|---|---|
| PubChem CID | 162620984 |
| Molecular Formula | C23H26F4O2 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 1-ethyl-2,2,3,3-tetrafluoro-4-[4-(4-propylphenyl)phenyl]cyclohexane-1,4-diol |
| SMILES | CCCc1ccc(-c2ccc(C3(O)CCC(O)(CC)C(F)(F)C3(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H26F4O2/c1-3-5-16-6-8-17(9-7-16)18-10-12-19(13-11-18)21(29)15-14-20(28,4-2)22(24,25)23(21,26)27/h6-13,28-29H,3-5,14-15H2,1-2H3 |
| InChIKey | NMVFPMZZCSDREM-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|