C36H24Cl4O3 — CID 99656591
(3S,3aR,9aR)-5,6,7,8-tetrachloro-3-methyl-1,2,3a,9a-tetraphenylcyclopenta[b][1,4]benzodioxin-3-ol (PubChem CID 99656591) has the molecular formula C36H24Cl4O3 and a molecular weight of 646.40 g/mol. Its IUPAC name is (3S,3aR,9aR)-5,6,7,8-tetrachloro-3-methyl-1,2,3a,9a-tetraphenylcyclopenta[b][1,4]benzodioxin-3-ol.
| Compound Name | (3S,3aR,9aR)-5,6,7,8-tetrachloro-3-methyl-1,2,3a,9a-tetraphenylcyclopenta[b][1,4]benzodioxin-3-ol |
|---|---|
| PubChem CID | 99656591 |
| Molecular Formula | C36H24Cl4O3 |
| Molecular Weight | 646.40 g/mol |
| Exact Mass | 644.05 |
| IUPAC Name | (3S,3aR,9aR)-5,6,7,8-tetrachloro-3-methyl-1,2,3a,9a-tetraphenylcyclopenta[b][1,4]benzodioxin-3-ol |
| SMILES | C[C@]1(O)C(c2ccccc2)=C(c2ccccc2)[C@@]2(c3ccccc3)Oc3c(Cl)c(Cl)c(Cl)c(Cl)c3O[C@]12c1ccccc1 |
| InChI | InChI=1S/C36H24Cl4O3/c1-34(41)26(22-14-6-2-7-15-22)27(23-16-8-3-9-17-23)35(24-18-10-4-11-19-24)36(34,25-20-12-5-13-21-25)43-33-31(40)29(38)28(37)30(39)32(33)42-35/h2-21,41H,1H3/t34-,35+,36+/m0/s1 |
| InChIKey | IRRUHGCVYLMGFD-LIVOIKKVSA-N |
| XLogP | 10.24 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.40 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|