C22H21N2O3P — CID 23416789
2,2-dimethoxy-4,5-diphenyl-3-oxa-1,7-diaza-2λ5-phosphatricyclo[6.4.0.02,6]dodeca-4,7,9,11-tetraene (PubChem CID 23416789) has the molecular formula C22H21N2O3P and a molecular weight of 392.40 g/mol. Its IUPAC name is 2,2-dimethoxy-4,5-diphenyl-3-oxa-1,7-diaza-2λ5-phosphatricyclo[6.4.0.02,6]dodeca-4,7,9,11-tetraene.
| Compound Name | 2,2-dimethoxy-4,5-diphenyl-3-oxa-1,7-diaza-2λ5-phosphatricyclo[6.4.0.02,6]dodeca-4,7,9,11-tetraene |
|---|---|
| PubChem CID | 23416789 |
| Molecular Formula | C22H21N2O3P |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2,2-dimethoxy-4,5-diphenyl-3-oxa-1,7-diaza-2λ5-phosphatricyclo[6.4.0.02,6]dodeca-4,7,9,11-tetraene |
| SMILES | COP12(OC)OC(c3ccccc3)=C(c3ccccc3)C1N=C1C=CC=CN12 |
| InChI | InChI=1S/C22H21N2O3P/c1-25-28(26-2)22(23-19-15-9-10-16-24(19)28)20(17-11-5-3-6-12-17)21(27-28)18-13-7-4-8-14-18/h3-16,22H,1-2H3 |
| InChIKey | ZEKQFOLJFCAZNS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|