C26H22O3 — CID 101075562
(1S,8R,9S,12R)-3,6-dimethoxy-10,11-diphenyl-13-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene (PubChem CID 101075562) has the molecular formula C26H22O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is (1S,8R,9S,12R)-3,6-dimethoxy-10,11-diphenyl-13-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene.
| Compound Name | (1S,8R,9S,12R)-3,6-dimethoxy-10,11-diphenyl-13-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene |
|---|---|
| PubChem CID | 101075562 |
| Molecular Formula | C26H22O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | (1S,8R,9S,12R)-3,6-dimethoxy-10,11-diphenyl-13-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene |
| SMILES | COc1ccc(OC)c2c1[C@H]1O[C@@H]2[C@@H]2C(c3ccccc3)=C(c3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C26H22O3/c1-27-17-13-14-18(28-2)22-21(17)25-23-19(15-9-5-3-6-10-15)20(24(23)26(22)29-25)16-11-7-4-8-12-16/h3-14,23-26H,1-2H3/t23-,24+,25+,26- |
| InChIKey | UYVCJZUKYPDXIV-FATVKVNYSA-N |
| XLogP | 5.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|