C19H24O3 — CID 101075560
(1S,8R,9R,12R)-3,6-dimethoxy-10-pentyl-13-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene (PubChem CID 101075560) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (1S,8R,9R,12R)-3,6-dimethoxy-10-pentyl-13-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene.
| Compound Name | (1S,8R,9R,12R)-3,6-dimethoxy-10-pentyl-13-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene |
|---|---|
| PubChem CID | 101075560 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (1S,8R,9R,12R)-3,6-dimethoxy-10-pentyl-13-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene |
| SMILES | CCCCCC1=C[C@@H]2[C@H]1[C@H]1O[C@@H]2c2c(OC)ccc(OC)c21 |
| InChI | InChI=1S/C19H24O3/c1-4-5-6-7-11-10-12-15(11)19-17-14(21-3)9-8-13(20-2)16(17)18(12)22-19/h8-10,12,15,18-19H,4-7H2,1-3H3/t12-,15+,18+,19-/m1/s1 |
| InChIKey | NQHUNEZHHLCWQV-NHAHKUSKSA-N |
| XLogP | 4.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|