C23H32O2 — CID 143112923
6-methoxy-5-(6-methoxy-3-pentylcyclohexa-2,4-dien-1-yl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 143112923) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is 6-methoxy-5-(6-methoxy-3-pentylcyclohexa-2,4-dien-1-yl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-methoxy-5-(6-methoxy-3-pentylcyclohexa-2,4-dien-1-yl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 143112923 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 6-methoxy-5-(6-methoxy-3-pentylcyclohexa-2,4-dien-1-yl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCCC1=CC(c2c(OC)ccc3c2CCCC3)C(OC)C=C1 |
| InChI | InChI=1S/C23H32O2/c1-4-5-6-9-17-12-14-21(24-2)20(16-17)23-19-11-8-7-10-18(19)13-15-22(23)25-3/h12-16,20-21H,4-11H2,1-3H3 |
| InChIKey | CQFZBANXOIAMCL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|