C29H28O3 — CID 102493503
(1R,8S,9S,10S)-3,6-dimethoxy-9-[(E)-2-phenylethenyl]-10-[(E)-1-phenylprop-1-en-2-yl]-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 102493503) has the molecular formula C29H28O3 and a molecular weight of 424.54 g/mol. Its IUPAC name is (1R,8S,9S,10S)-3,6-dimethoxy-9-[(E)-2-phenylethenyl]-10-[(E)-1-phenylprop-1-en-2-yl]-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1R,8S,9S,10S)-3,6-dimethoxy-9-[(E)-2-phenylethenyl]-10-[(E)-1-phenylprop-1-en-2-yl]-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 102493503 |
| Molecular Formula | C29H28O3 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | (1R,8S,9S,10S)-3,6-dimethoxy-9-[(E)-2-phenylethenyl]-10-[(E)-1-phenylprop-1-en-2-yl]-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | COc1ccc(OC)c2c1[C@H]1O[C@@H]2[C@H](/C(C)=C/c2ccccc2)[C@@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C29H28O3/c1-19(18-21-12-8-5-9-13-21)25-22(15-14-20-10-6-4-7-11-20)28-26-23(30-2)16-17-24(31-3)27(26)29(25)32-28/h4-18,22,25,28-29H,1-3H3/b15-14+,19-18+/t22-,25+,28-,29+/m0/s1 |
| InChIKey | OQRDOONBULRMLQ-YBEGMMKTSA-N |
| XLogP | 6.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |