C19H18O4S — CID 142108644
5,5-dimethyl-4-(4-methylsulfinylphenyl)-3-phenoxyfuran-2-one (PubChem CID 142108644) has the molecular formula C19H18O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is 5,5-dimethyl-4-(4-methylsulfinylphenyl)-3-phenoxyfuran-2-one.
| Compound Name | 5,5-dimethyl-4-(4-methylsulfinylphenyl)-3-phenoxyfuran-2-one |
|---|---|
| PubChem CID | 142108644 |
| Molecular Formula | C19H18O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 5,5-dimethyl-4-(4-methylsulfinylphenyl)-3-phenoxyfuran-2-one |
| SMILES | CS(=O)c1ccc(C2=C(Oc3ccccc3)C(=O)OC2(C)C)cc1 |
| InChI | InChI=1S/C19H18O4S/c1-19(2)16(13-9-11-15(12-10-13)24(3)21)17(18(20)23-19)22-14-7-5-4-6-8-14/h4-12H,1-3H3 |
| InChIKey | GSZOTGJHOHSPSP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |