C19H18N2OS — CID 100976473
4-N-(4-methylsulfinylphenyl)-1-N-phenylbenzene-1,4-diamine (PubChem CID 100976473) has the molecular formula C19H18N2OS and a molecular weight of 322.43 g/mol. Its IUPAC name is 4-N-(4-methylsulfinylphenyl)-1-N-phenylbenzene-1,4-diamine.
| Compound Name | 4-N-(4-methylsulfinylphenyl)-1-N-phenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 100976473 |
| Molecular Formula | C19H18N2OS |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 4-N-(4-methylsulfinylphenyl)-1-N-phenylbenzene-1,4-diamine |
| SMILES | CS(=O)c1ccc(Nc2ccc(Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C19H18N2OS/c1-23(22)19-13-11-18(12-14-19)21-17-9-7-16(8-10-17)20-15-5-3-2-4-6-15/h2-14,20-21H,1H3 |
| InChIKey | LNACTIJZFMIXPC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |