About cumene;methylsulfinylbenzene
cumene;methylsulfinylbenzene (PubChem CID 143291926) has the molecular formula C16H20OS
and a molecular weight of 260.40 g/mol. Its IUPAC name is cumene;methylsulfinylbenzene.
Molecular Properties
| Compound Name | cumene;methylsulfinylbenzene |
| PubChem CID | 143291926 |
| Molecular Formula | C16H20OS |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | cumene;methylsulfinylbenzene |
| SMILES | CC(C)c1ccccc1.CS(=O)c1ccccc1 |
| InChI | InChI=1S/C9H12.C7H8OS/c1-8(2)9-6-4-3-5-7-9;1-9(8)7-5-3-2-4-6-7/h3-8H,1-2H3;2-6H,1H3 |
| InChIKey | MNLNBASMLKUXOF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cumene;methylsulfinylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;methylsulfinylbenzene?
The IUPAC name of cumene;methylsulfinylbenzene (CID 143291926) is cumene;methylsulfinylbenzene.
What is the SMILES notation for cumene;methylsulfinylbenzene?
The canonical SMILES for cumene;methylsulfinylbenzene is CC(C)c1ccccc1.CS(=O)c1ccccc1.
What is the InChIKey of cumene;methylsulfinylbenzene?
The InChIKey is MNLNBASMLKUXOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C7H8OS/c1-8(2)9-6-4-3-5-7-9;1-9(8)7-5-3-2-4-6-7/h3-8H,1-2H3;2-6H,1H3.
What are the key properties of cumene;methylsulfinylbenzene?
cumene;methylsulfinylbenzene has a molecular weight of 260.40 g/mol, XLogP of 4.23, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;methylsulfinylbenzene is sourced from PubChem (CID 143291926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).