C37H26O2 — CID 10929217
(1S,5R)-1,3,5,6,7-pentakis-phenyl-8-oxabicyclo[3.2.1]octa-3,6-dien-2-one (PubChem CID 10929217) has the molecular formula C37H26O2 and a molecular weight of 502.61 g/mol. Its IUPAC name is (1S,5R)-1,3,5,6,7-pentakis-phenyl-8-oxabicyclo[3.2.1]octa-3,6-dien-2-one.
| Compound Name | (1S,5R)-1,3,5,6,7-pentakis-phenyl-8-oxabicyclo[3.2.1]octa-3,6-dien-2-one |
|---|---|
| PubChem CID | 10929217 |
| Molecular Formula | C37H26O2 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | (1S,5R)-1,3,5,6,7-pentakis-phenyl-8-oxabicyclo[3.2.1]octa-3,6-dien-2-one |
| SMILES | O=C1C(c2ccccc2)=C[C@]2(c3ccccc3)O[C@@]1(c1ccccc1)C(c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C37H26O2/c38-35-32(27-16-6-1-7-17-27)26-36(30-22-12-4-13-23-30)33(28-18-8-2-9-19-28)34(29-20-10-3-11-21-29)37(35,39-36)31-24-14-5-15-25-31/h1-26H/t36-,37+/m1/s1 |
| InChIKey | NAJZCVRGABBJCG-AARKOHAPSA-N |
| XLogP | 8.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|