C35H26O3S — CID 11699339
(1R,8S)-9-(4-methylphenyl)sulfonyl-1,8,10-triphenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene (PubChem CID 11699339) has the molecular formula C35H26O3S and a molecular weight of 526.66 g/mol. Its IUPAC name is (1R,8S)-9-(4-methylphenyl)sulfonyl-1,8,10-triphenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene.
| Compound Name | (1R,8S)-9-(4-methylphenyl)sulfonyl-1,8,10-triphenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
|---|---|
| PubChem CID | 11699339 |
| Molecular Formula | C35H26O3S |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | (1R,8S)-9-(4-methylphenyl)sulfonyl-1,8,10-triphenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
| SMILES | Cc1ccc(S(=O)(=O)C2=C(c3ccccc3)[C@]3(c4ccccc4)O[C@@]2(c2ccccc2)c2ccccc23)cc1 |
| InChI | InChI=1S/C35H26O3S/c1-25-21-23-29(24-22-25)39(36,37)33-32(26-13-5-2-6-14-26)34(27-15-7-3-8-16-27)30-19-11-12-20-31(30)35(33,38-34)28-17-9-4-10-18-28/h2-24H,1H3/t34-,35+/m1/s1 |
| InChIKey | RQHFBIIVFQIEHQ-GPOMZPHUSA-N |
| XLogP | 7.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |