C24H29NO2 — CID 101437580
5-hydroxy-3,5-diphenyl-1-(2,4,4-trimethylpentan-2-yl)pyrrol-2-one (PubChem CID 101437580) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is 5-hydroxy-3,5-diphenyl-1-(2,4,4-trimethylpentan-2-yl)pyrrol-2-one.
| Compound Name | 5-hydroxy-3,5-diphenyl-1-(2,4,4-trimethylpentan-2-yl)pyrrol-2-one |
|---|---|
| PubChem CID | 101437580 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 5-hydroxy-3,5-diphenyl-1-(2,4,4-trimethylpentan-2-yl)pyrrol-2-one |
| SMILES | CC(C)(C)CC(C)(C)N1C(=O)C(c2ccccc2)=CC1(O)c1ccccc1 |
| InChI | InChI=1S/C24H29NO2/c1-22(2,3)17-23(4,5)25-21(26)20(18-12-8-6-9-13-18)16-24(25,27)19-14-10-7-11-15-19/h6-16,27H,17H2,1-5H3 |
| InChIKey | ZUQVKYWYDXIFDD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |