C16H23N3S — CID 63547438
3-phenyl-4-(2,4,4-trimethylpentan-2-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 63547438) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is 3-phenyl-4-(2,4,4-trimethylpentan-2-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-phenyl-4-(2,4,4-trimethylpentan-2-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 63547438 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 3-phenyl-4-(2,4,4-trimethylpentan-2-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)(C)CC(C)(C)n1c(-c2ccccc2)n[nH]c1=S |
| InChI | InChI=1S/C16H23N3S/c1-15(2,3)11-16(4,5)19-13(17-18-14(19)20)12-9-7-6-8-10-12/h6-10H,11H2,1-5H3,(H,18,20) |
| InChIKey | MAHZFJMGJUGBTQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|