C24H20N4O2 — CID 139233808
3-(4-methoxyphenyl)-4,4-diphenyl-1-(1H-1,2,4-triazol-5-yl)azetidin-2-one (PubChem CID 139233808) has the molecular formula C24H20N4O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4,4-diphenyl-1-(1H-1,2,4-triazol-5-yl)azetidin-2-one.
| Compound Name | 3-(4-methoxyphenyl)-4,4-diphenyl-1-(1H-1,2,4-triazol-5-yl)azetidin-2-one |
|---|---|
| PubChem CID | 139233808 |
| Molecular Formula | C24H20N4O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 3-(4-methoxyphenyl)-4,4-diphenyl-1-(1H-1,2,4-triazol-5-yl)azetidin-2-one |
| SMILES | COc1ccc(C2C(=O)N(c3ncn[nH]3)C2(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N4O2/c1-30-20-14-12-17(13-15-20)21-22(29)28(23-25-16-26-27-23)24(21,18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-16,21H,1H3,(H,25,26,27) |
| InChIKey | VJEMEXVSHVMTIX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |