C23H18N4O2 — CID 139233812
3-(2-hydroxyphenyl)-4,4-diphenyl-1-(1H-1,2,4-triazol-5-yl)azetidin-2-one (PubChem CID 139233812) has the molecular formula C23H18N4O2 and a molecular weight of 382.42 g/mol. Its IUPAC name is 3-(2-hydroxyphenyl)-4,4-diphenyl-1-(1H-1,2,4-triazol-5-yl)azetidin-2-one.
| Compound Name | 3-(2-hydroxyphenyl)-4,4-diphenyl-1-(1H-1,2,4-triazol-5-yl)azetidin-2-one |
|---|---|
| PubChem CID | 139233812 |
| Molecular Formula | C23H18N4O2 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 3-(2-hydroxyphenyl)-4,4-diphenyl-1-(1H-1,2,4-triazol-5-yl)azetidin-2-one |
| SMILES | O=C1C(c2ccccc2O)C(c2ccccc2)(c2ccccc2)N1c1ncn[nH]1 |
| InChI | InChI=1S/C23H18N4O2/c28-19-14-8-7-13-18(19)20-21(29)27(22-24-15-25-26-22)23(20,16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-15,20,28H,(H,24,25,26) |
| InChIKey | GQEOPIOXQMRVLT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |