C19H16N2O2 — CID 57328295
1-(4-methoxyphenyl)-4-methylidene-5-oxo-2-phenylpyrrolidine-2-carbonitrile (PubChem CID 57328295) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-methylidene-5-oxo-2-phenylpyrrolidine-2-carbonitrile.
| Compound Name | 1-(4-methoxyphenyl)-4-methylidene-5-oxo-2-phenylpyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 57328295 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-methylidene-5-oxo-2-phenylpyrrolidine-2-carbonitrile |
| SMILES | C=C1CC(C#N)(c2ccccc2)N(c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C19H16N2O2/c1-14-12-19(13-20,15-6-4-3-5-7-15)21(18(14)22)16-8-10-17(23-2)11-9-16/h3-11H,1,12H2,2H3 |
| InChIKey | UYUHGGAYVBOQBS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|