C20H20N2O3 — CID 139093421
methyl (3R,5R)-5-cyano-1-(4-methoxyphenyl)-5-phenylpyrrolidine-3-carboxylate (PubChem CID 139093421) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is methyl (3R,5R)-5-cyano-1-(4-methoxyphenyl)-5-phenylpyrrolidine-3-carboxylate.
| Compound Name | methyl (3R,5R)-5-cyano-1-(4-methoxyphenyl)-5-phenylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 139093421 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | methyl (3R,5R)-5-cyano-1-(4-methoxyphenyl)-5-phenylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CN(c2ccc(OC)cc2)[C@@](C#N)(c2ccccc2)C1 |
| InChI | InChI=1S/C20H20N2O3/c1-24-18-10-8-17(9-11-18)22-13-15(19(23)25-2)12-20(22,14-21)16-6-4-3-5-7-16/h3-11,15H,12-13H2,1-2H3/t15-,20+/m1/s1 |
| InChIKey | ZGRNNZWBCALALI-QRWLVFNGSA-N |
| XLogP | 3.11 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|