C17H17NO3 — CID 141180829
4-(4-methoxyphenyl)-2,2-dimethyl-1,4-benzoxazin-3-one (PubChem CID 141180829) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2,2-dimethyl-1,4-benzoxazin-3-one.
| Compound Name | 4-(4-methoxyphenyl)-2,2-dimethyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 141180829 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4-(4-methoxyphenyl)-2,2-dimethyl-1,4-benzoxazin-3-one |
| SMILES | COc1ccc(N2C(=O)C(C)(C)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C17H17NO3/c1-17(2)16(19)18(12-8-10-13(20-3)11-9-12)14-6-4-5-7-15(14)21-17/h4-11H,1-3H3 |
| InChIKey | HUBYCBXYIJKTCH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |