C15H10FNO3 — CID 2786500
8-fluoro-3-hydroxy-3-phenyl-1H-quinoline-2,4-dione (PubChem CID 2786500) has the molecular formula C15H10FNO3 and a molecular weight of 271.25 g/mol. Its IUPAC name is 8-fluoro-3-hydroxy-3-phenyl-1H-quinoline-2,4-dione.
| Compound Name | 8-fluoro-3-hydroxy-3-phenyl-1H-quinoline-2,4-dione |
|---|---|
| PubChem CID | 2786500 |
| Molecular Formula | C15H10FNO3 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 8-fluoro-3-hydroxy-3-phenyl-1H-quinoline-2,4-dione |
| SMILES | O=C1Nc2c(F)cccc2C(=O)C1(O)c1ccccc1 |
| InChI | InChI=1S/C15H10FNO3/c16-11-8-4-7-10-12(11)17-14(19)15(20,13(10)18)9-5-2-1-3-6-9/h1-8,20H,(H,17,19) |
| InChIKey | INEPABJTKFYZBE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|