C17H16N2O3 — CID 102141067
3-hydroxy-N,N-dimethyl-2-oxo-3-phenyl-1H-indole-4-carboxamide (PubChem CID 102141067) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 3-hydroxy-N,N-dimethyl-2-oxo-3-phenyl-1H-indole-4-carboxamide.
| Compound Name | 3-hydroxy-N,N-dimethyl-2-oxo-3-phenyl-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 102141067 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-hydroxy-N,N-dimethyl-2-oxo-3-phenyl-1H-indole-4-carboxamide |
| SMILES | CN(C)C(=O)c1cccc2c1C(O)(c1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C17H16N2O3/c1-19(2)15(20)12-9-6-10-13-14(12)17(22,16(21)18-13)11-7-4-3-5-8-11/h3-10,22H,1-2H3,(H,18,21) |
| InChIKey | LARIDDMHPMVSPD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |