C15H11FN2O — CID 138736880
9-fluoro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 138736880) has the molecular formula C15H11FN2O and a molecular weight of 254.26 g/mol. Its IUPAC name is 9-fluoro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | 9-fluoro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 138736880 |
| Molecular Formula | C15H11FN2O |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 9-fluoro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | O=C1CN=C(c2ccccc2)c2cccc(F)c2N1 |
| InChI | InChI=1S/C15H11FN2O/c16-12-8-4-7-11-14(10-5-2-1-3-6-10)17-9-13(19)18-15(11)12/h1-8H,9H2,(H,18,19) |
| InChIKey | UUQCAOAKOGVMJB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |